C17H16ClN3O3S — CID 10068194
5-chloro-3-(2-phenylethylsulfamoyl)-1H-indole-2-carboxamide (PubChem CID 10068194) has the molecular formula C17H16ClN3O3S and a molecular weight of 377.85 g/mol. Its IUPAC name is 5-chloro-3-(2-phenylethylsulfamoyl)-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-(2-phenylethylsulfamoyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 10068194 |
| Molecular Formula | C17H16ClN3O3S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 5-chloro-3-(2-phenylethylsulfamoyl)-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1[nH]c2ccc(Cl)cc2c1S(=O)(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C17H16ClN3O3S/c18-12-6-7-14-13(10-12)16(15(21-14)17(19)22)25(23,24)20-9-8-11-4-2-1-3-5-11/h1-7,10,20-21H,8-9H2,(H2,19,22) |
| InChIKey | LFZBJQJZWVNDTB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |