C15H17ClN4O4S — CID 10068626
3-(4-acetylpiperazin-1-yl)sulfonyl-5-chloro-1H-indole-2-carboxamide (PubChem CID 10068626) has the molecular formula C15H17ClN4O4S and a molecular weight of 384.85 g/mol. Its IUPAC name is 3-(4-acetylpiperazin-1-yl)sulfonyl-5-chloro-1H-indole-2-carboxamide.
| Compound Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-5-chloro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 10068626 |
| Molecular Formula | C15H17ClN4O4S |
| Molecular Weight | 384.85 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 3-(4-acetylpiperazin-1-yl)sulfonyl-5-chloro-1H-indole-2-carboxamide |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2c(C(N)=O)[nH]c3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C15H17ClN4O4S/c1-9(21)19-4-6-20(7-5-19)25(23,24)14-11-8-10(16)2-3-12(11)18-13(14)15(17)22/h2-3,8,18H,4-7H2,1H3,(H2,17,22) |
| InChIKey | NVJJBPAWEMXLMX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.85 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |