C13H14N4O6S — CID 10428193
3-morpholin-4-ylsulfonyl-5-nitro-1H-indole-2-carboxamide (PubChem CID 10428193) has the molecular formula C13H14N4O6S and a molecular weight of 354.34 g/mol. Its IUPAC name is 3-morpholin-4-ylsulfonyl-5-nitro-1H-indole-2-carboxamide.
| Compound Name | 3-morpholin-4-ylsulfonyl-5-nitro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 10428193 |
| Molecular Formula | C13H14N4O6S |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 3-morpholin-4-ylsulfonyl-5-nitro-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1[nH]c2ccc([N+](=O)[O-])cc2c1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H14N4O6S/c14-13(18)11-12(24(21,22)16-3-5-23-6-4-16)9-7-8(17(19)20)1-2-10(9)15-11/h1-2,7,15H,3-6H2,(H2,14,18) |
| InChIKey | ATJXRQUNMXDJBI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 148.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|