C13H13AsBrN3O4S — CID 87733354
CID 87733354 (PubChem CID 87733354) has the molecular formula C13H13AsBrN3O4S and a molecular weight of 462.16 g/mol.
| Compound Name | CID 87733354 |
|---|---|
| PubChem CID | 87733354 |
| Molecular Formula | C13H13AsBrN3O4S |
| Molecular Weight | 462.16 g/mol |
| Exact Mass | 460.90 |
| IUPAC Name | — |
| SMILES | NC(=O)c1[nH]c2ccc(Br)c([As])c2c1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H13AsBrN3O4S/c14-10-7(15)1-2-8-9(10)12(11(17-8)13(16)19)23(20,21)18-3-5-22-6-4-18/h1-2,17H,3-6H2,(H2,16,19) |
| InChIKey | KWSSCKHBVCFYNW-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.16 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|