C18H17N3O5S — CID 131724381
2-[3-(3,5-dimethylphenyl)sulfonyl-5-nitro-1H-indol-2-yl]acetamide (PubChem CID 131724381) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylphenyl)sulfonyl-5-nitro-1H-indol-2-yl]acetamide.
| Compound Name | 2-[3-(3,5-dimethylphenyl)sulfonyl-5-nitro-1H-indol-2-yl]acetamide |
|---|---|
| PubChem CID | 131724381 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-[3-(3,5-dimethylphenyl)sulfonyl-5-nitro-1H-indol-2-yl]acetamide |
| SMILES | Cc1cc(C)cc(S(=O)(=O)c2c(CC(N)=O)[nH]c3ccc([N+](=O)[O-])cc23)c1 |
| InChI | InChI=1S/C18H17N3O5S/c1-10-5-11(2)7-13(6-10)27(25,26)18-14-8-12(21(23)24)3-4-15(14)20-16(18)9-17(19)22/h3-8,20H,9H2,1-2H3,(H2,19,22) |
| InChIKey | RQQILLDGQBFIBR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|