C18H16N6O8S — CID 4664439
3-[(4-morpholin-4-ylsulfonyl-2-nitrophenyl)diazenyl]-5-nitro-1H-indol-2-ol (PubChem CID 4664439) has the molecular formula C18H16N6O8S and a molecular weight of 476.43 g/mol. Its IUPAC name is 3-[(4-morpholin-4-ylsulfonyl-2-nitrophenyl)diazenyl]-5-nitro-1H-indol-2-ol.
| Compound Name | 3-[(4-morpholin-4-ylsulfonyl-2-nitrophenyl)diazenyl]-5-nitro-1H-indol-2-ol |
|---|---|
| PubChem CID | 4664439 |
| Molecular Formula | C18H16N6O8S |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 3-[(4-morpholin-4-ylsulfonyl-2-nitrophenyl)diazenyl]-5-nitro-1H-indol-2-ol |
| SMILES | O=[N+]([O-])c1ccc2[nH]c(O)c(/N=N/c3ccc(S(=O)(=O)N4CCOCC4)cc3[N+](=O)[O-])c2c1 |
| InChI | InChI=1S/C18H16N6O8S/c25-18-17(13-9-11(23(26)27)1-3-14(13)19-18)21-20-15-4-2-12(10-16(15)24(28)29)33(30,31)22-5-7-32-8-6-22/h1-4,9-10,19,25H,5-8H2/b21-20+ |
| InChIKey | ZRKZTMCCNFJOJB-QZQOTICOSA-N |
| XLogP | 3.13 |
| TPSA | 193.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|