C19H20N6O5S — CID 137172475
3-[[2-(4-methylpiperazin-1-yl)sulfonyl-4-nitrophenyl]diazenyl]-1H-indol-2-ol (PubChem CID 137172475) has the molecular formula C19H20N6O5S and a molecular weight of 444.47 g/mol. Its IUPAC name is 3-[[2-(4-methylpiperazin-1-yl)sulfonyl-4-nitrophenyl]diazenyl]-1H-indol-2-ol.
| Compound Name | 3-[[2-(4-methylpiperazin-1-yl)sulfonyl-4-nitrophenyl]diazenyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 137172475 |
| Molecular Formula | C19H20N6O5S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 3-[[2-(4-methylpiperazin-1-yl)sulfonyl-4-nitrophenyl]diazenyl]-1H-indol-2-ol |
| SMILES | CN1CCN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2/N=N/c2c(O)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C19H20N6O5S/c1-23-8-10-24(11-9-23)31(29,30)17-12-13(25(27)28)6-7-16(17)21-22-18-14-4-2-3-5-15(14)20-19(18)26/h2-7,12,20,26H,8-11H2,1H3/b22-21+ |
| InChIKey | HCPZOQXALVOABS-QURGRASLSA-N |
| XLogP | 3.13 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|