C26H25N5O5S — CID 136766812
1-methyl-3-[[4-nitro-2-(4-phenylpiperidin-1-yl)sulfonylphenyl]diazenyl]indol-2-ol (PubChem CID 136766812) has the molecular formula C26H25N5O5S and a molecular weight of 519.58 g/mol. Its IUPAC name is 1-methyl-3-[[4-nitro-2-(4-phenylpiperidin-1-yl)sulfonylphenyl]diazenyl]indol-2-ol.
| Compound Name | 1-methyl-3-[[4-nitro-2-(4-phenylpiperidin-1-yl)sulfonylphenyl]diazenyl]indol-2-ol |
|---|---|
| PubChem CID | 136766812 |
| Molecular Formula | C26H25N5O5S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 1-methyl-3-[[4-nitro-2-(4-phenylpiperidin-1-yl)sulfonylphenyl]diazenyl]indol-2-ol |
| SMILES | Cn1c(O)c(/N=N/c2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCC(c3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C26H25N5O5S/c1-29-23-10-6-5-9-21(23)25(26(29)32)28-27-22-12-11-20(31(33)34)17-24(22)37(35,36)30-15-13-19(14-16-30)18-7-3-2-4-8-18/h2-12,17,19,32H,13-16H2,1H3/b28-27+ |
| InChIKey | YDBMYKSGRYRBHN-BYYHNAKLSA-N |
| XLogP | 5.78 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|