C19H19N5O5S — CID 137172473
3-[(4-nitro-2-piperidin-1-ylsulfonylphenyl)diazenyl]-1H-indol-2-ol (PubChem CID 137172473) has the molecular formula C19H19N5O5S and a molecular weight of 429.46 g/mol. Its IUPAC name is 3-[(4-nitro-2-piperidin-1-ylsulfonylphenyl)diazenyl]-1H-indol-2-ol.
| Compound Name | 3-[(4-nitro-2-piperidin-1-ylsulfonylphenyl)diazenyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 137172473 |
| Molecular Formula | C19H19N5O5S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 3-[(4-nitro-2-piperidin-1-ylsulfonylphenyl)diazenyl]-1H-indol-2-ol |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2c(O)[nH]c3ccccc23)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H19N5O5S/c25-19-18(14-6-2-3-7-15(14)20-19)22-21-16-9-8-13(24(26)27)12-17(16)30(28,29)23-10-4-1-5-11-23/h2-3,6-9,12,20,25H,1,4-5,10-11H2/b22-21+ |
| InChIKey | YUUBYUBWIDZCNA-QURGRASLSA-N |
| XLogP | 4.37 |
| TPSA | 141.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|