C22H25N5O5S — CID 136766805
N-cyclohexyl-2-[(2-hydroxy-1-methylindol-3-yl)diazenyl]-N-methyl-5-nitrobenzenesulfonamide (PubChem CID 136766805) has the molecular formula C22H25N5O5S and a molecular weight of 471.54 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2-hydroxy-1-methylindol-3-yl)diazenyl]-N-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-cyclohexyl-2-[(2-hydroxy-1-methylindol-3-yl)diazenyl]-N-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 136766805 |
| Molecular Formula | C22H25N5O5S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-cyclohexyl-2-[(2-hydroxy-1-methylindol-3-yl)diazenyl]-N-methyl-5-nitrobenzenesulfonamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1cc([N+](=O)[O-])ccc1/N=N/c1c(O)n(C)c2ccccc12 |
| InChI | InChI=1S/C22H25N5O5S/c1-25-19-11-7-6-10-17(19)21(22(25)28)24-23-18-13-12-16(27(29)30)14-20(18)33(31,32)26(2)15-8-4-3-5-9-15/h6-7,10-15,28H,3-5,8-9H2,1-2H3/b24-23+ |
| InChIKey | AUNAZSSUJYHAAM-WCWDXBQESA-N |
| XLogP | 5.16 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|