C21H23N5O5S — CID 137172485
3-[[2-[(2R,4R)-2,4-dimethylpiperidin-1-yl]sulfonyl-4-nitrophenyl]diazenyl]-1H-indol-2-ol (PubChem CID 137172485) has the molecular formula C21H23N5O5S and a molecular weight of 457.51 g/mol. Its IUPAC name is 3-[[2-[(2R,4R)-2,4-dimethylpiperidin-1-yl]sulfonyl-4-nitrophenyl]diazenyl]-1H-indol-2-ol.
| Compound Name | 3-[[2-[(2R,4R)-2,4-dimethylpiperidin-1-yl]sulfonyl-4-nitrophenyl]diazenyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 137172485 |
| Molecular Formula | C21H23N5O5S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 3-[[2-[(2R,4R)-2,4-dimethylpiperidin-1-yl]sulfonyl-4-nitrophenyl]diazenyl]-1H-indol-2-ol |
| SMILES | C[C@@H]1CCN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2/N=N/c2c(O)[nH]c3ccccc23)[C@H](C)C1 |
| InChI | InChI=1S/C21H23N5O5S/c1-13-9-10-25(14(2)11-13)32(30,31)19-12-15(26(28)29)7-8-18(19)23-24-20-16-5-3-4-6-17(16)22-21(20)27/h3-8,12-14,22,27H,9-11H2,1-2H3/b24-23+/t13-,14-/m1/s1 |
| InChIKey | GBMVGTGKMJAFDX-SVWFUCTISA-N |
| XLogP | 5.01 |
| TPSA | 141.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|