C21H24N4O6S — CID 93145591
N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[(2R,4R)-2,4-dimethylpiperidin-1-yl]sulfonyl-4-nitroaniline (PubChem CID 93145591) has the molecular formula C21H24N4O6S and a molecular weight of 460.51 g/mol. Its IUPAC name is N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[(2R,4R)-2,4-dimethylpiperidin-1-yl]sulfonyl-4-nitroaniline.
| Compound Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[(2R,4R)-2,4-dimethylpiperidin-1-yl]sulfonyl-4-nitroaniline |
|---|---|
| PubChem CID | 93145591 |
| Molecular Formula | C21H24N4O6S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[(2R,4R)-2,4-dimethylpiperidin-1-yl]sulfonyl-4-nitroaniline |
| SMILES | C[C@@H]1CCN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2N/N=C\c2ccc3c(c2)OCO3)[C@H](C)C1 |
| InChI | InChI=1S/C21H24N4O6S/c1-14-7-8-24(15(2)9-14)32(28,29)21-11-17(25(26)27)4-5-18(21)23-22-12-16-3-6-19-20(10-16)31-13-30-19/h3-6,10-12,14-15,23H,7-9,13H2,1-2H3/b22-12-/t14-,15-/m1/s1 |
| InChIKey | YMIHJQITXUXBHY-LXNRVDKDSA-N |
| XLogP | 3.58 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|