C21H25N5O7S — CID 94849551
1-[2-[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-5-nitrophenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 94849551) has the molecular formula C21H25N5O7S and a molecular weight of 491.53 g/mol. Its IUPAC name is 1-[2-[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-5-nitrophenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-5-nitrophenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 94849551 |
| Molecular Formula | C21H25N5O7S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 1-[2-[(2Z)-2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-5-nitrophenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | COc1ccc(/C=N\Nc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCC(C(N)=O)CC2)cc1OC |
| InChI | InChI=1S/C21H25N5O7S/c1-32-18-6-3-14(11-19(18)33-2)13-23-24-17-5-4-16(26(28)29)12-20(17)34(30,31)25-9-7-15(8-10-25)21(22)27/h3-6,11-13,15,24H,7-10H2,1-2H3,(H2,22,27)/b23-13- |
| InChIKey | OFOQEGXGEORZGS-QRVIBDJDSA-N |
| XLogP | 1.94 |
| TPSA | 166.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|