C21H25N7O7S — CID 94849558
1-[2-[(2Z)-2-[[2-(dimethylamino)-5-nitrophenyl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 94849558) has the molecular formula C21H25N7O7S and a molecular weight of 519.54 g/mol. Its IUPAC name is 1-[2-[(2Z)-2-[[2-(dimethylamino)-5-nitrophenyl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[(2Z)-2-[[2-(dimethylamino)-5-nitrophenyl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 94849558 |
| Molecular Formula | C21H25N7O7S |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 1-[2-[(2Z)-2-[[2-(dimethylamino)-5-nitrophenyl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | CN(C)c1ccc([N+](=O)[O-])cc1/C=N\Nc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C21H25N7O7S/c1-25(2)19-6-4-16(27(30)31)11-15(19)13-23-24-18-5-3-17(28(32)33)12-20(18)36(34,35)26-9-7-14(8-10-26)21(22)29/h3-6,11-14,24H,7-10H2,1-2H3,(H2,22,29)/b23-13- |
| InChIKey | UAZIRPCBBIBCJZ-QRVIBDJDSA-N |
| XLogP | 1.90 |
| TPSA | 194.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|