C17H18N4O6S — CID 135678967
2-[(E)-[(2-morpholin-4-ylsulfonyl-4-nitrophenyl)hydrazinylidene]methyl]phenol (PubChem CID 135678967) has the molecular formula C17H18N4O6S and a molecular weight of 406.42 g/mol. Its IUPAC name is 2-[(E)-[(2-morpholin-4-ylsulfonyl-4-nitrophenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-[(E)-[(2-morpholin-4-ylsulfonyl-4-nitrophenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135678967 |
| Molecular Formula | C17H18N4O6S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2-[(E)-[(2-morpholin-4-ylsulfonyl-4-nitrophenyl)hydrazinylidene]methyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(N/N=C/c2ccccc2O)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H18N4O6S/c22-16-4-2-1-3-13(16)12-18-19-15-6-5-14(21(23)24)11-17(15)28(25,26)20-7-9-27-10-8-20/h1-6,11-12,19,22H,7-10H2/b18-12+ |
| InChIKey | NDPHJCUDSRUUNF-LDADJPATSA-N |
| XLogP | 1.77 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|