C20H24N4O8S — CID 4285928
2-morpholin-4-ylsulfonyl-4-nitro-N-[(3,4,5-trimethoxyphenyl)methylideneamino]aniline (PubChem CID 4285928) has the molecular formula C20H24N4O8S and a molecular weight of 480.50 g/mol. Its IUPAC name is 2-morpholin-4-ylsulfonyl-4-nitro-N-[(3,4,5-trimethoxyphenyl)methylideneamino]aniline.
| Compound Name | 2-morpholin-4-ylsulfonyl-4-nitro-N-[(3,4,5-trimethoxyphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 4285928 |
| Molecular Formula | C20H24N4O8S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 2-morpholin-4-ylsulfonyl-4-nitro-N-[(3,4,5-trimethoxyphenyl)methylideneamino]aniline |
| SMILES | COc1cc(C=NNc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCOCC2)cc(OC)c1OC |
| InChI | InChI=1S/C20H24N4O8S/c1-29-17-10-14(11-18(30-2)20(17)31-3)13-21-22-16-5-4-15(24(25)26)12-19(16)33(27,28)23-6-8-32-9-7-23/h4-5,10-13,22H,6-9H2,1-3H3 |
| InChIKey | ITORTWDAVOWQRV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|