C17H19N3O7S — CID 24507995
2-methoxy-5-(2-morpholin-4-ylsulfonyl-4-nitroanilino)phenol (PubChem CID 24507995) has the molecular formula C17H19N3O7S and a molecular weight of 409.42 g/mol. Its IUPAC name is 2-methoxy-5-(2-morpholin-4-ylsulfonyl-4-nitroanilino)phenol.
| Compound Name | 2-methoxy-5-(2-morpholin-4-ylsulfonyl-4-nitroanilino)phenol |
|---|---|
| PubChem CID | 24507995 |
| Molecular Formula | C17H19N3O7S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 2-methoxy-5-(2-morpholin-4-ylsulfonyl-4-nitroanilino)phenol |
| SMILES | COc1ccc(Nc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCOCC2)cc1O |
| InChI | InChI=1S/C17H19N3O7S/c1-26-16-5-2-12(10-15(16)21)18-14-4-3-13(20(22)23)11-17(14)28(24,25)19-6-8-27-9-7-19/h2-5,10-11,18,21H,6-9H2,1H3 |
| InChIKey | WEAGNNVPIZMFDP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|