C24H27N7O6S2 — CID 98064920
2-[(2S,4S)-2,4-dimethylpiperidin-1-yl]sulfonyl-N-[(Z)-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]-4-nitroaniline (PubChem CID 98064920) has the molecular formula C24H27N7O6S2 and a molecular weight of 573.66 g/mol. Its IUPAC name is 2-[(2S,4S)-2,4-dimethylpiperidin-1-yl]sulfonyl-N-[(Z)-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]-4-nitroaniline.
| Compound Name | 2-[(2S,4S)-2,4-dimethylpiperidin-1-yl]sulfonyl-N-[(Z)-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 98064920 |
| Molecular Formula | C24H27N7O6S2 |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | 2-[(2S,4S)-2,4-dimethylpiperidin-1-yl]sulfonyl-N-[(Z)-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]-4-nitroaniline |
| SMILES | C[C@H]1CCN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2N/N=C\c2ccc(Sc3nccn3C)c([N+](=O)[O-])c2)[C@@H](C)C1 |
| InChI | InChI=1S/C24H27N7O6S2/c1-16-8-10-29(17(2)12-16)39(36,37)23-14-19(30(32)33)5-6-20(23)27-26-15-18-4-7-22(21(13-18)31(34)35)38-24-25-9-11-28(24)3/h4-7,9,11,13-17,27H,8,10,12H2,1-3H3/b26-15-/t16-,17-/m0/s1 |
| InChIKey | QJMBOOLWYLECBB-UJFKDCKASA-N |
| XLogP | 4.64 |
| TPSA | 165.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|