C32H27N7O6S2 — CID 124598206
4-nitro-N-[(Z)-(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylideneamino]-2-(4-phenylpiperazin-1-yl)sulfonylaniline (PubChem CID 124598206) has the molecular formula C32H27N7O6S2 and a molecular weight of 669.75 g/mol. Its IUPAC name is 4-nitro-N-[(Z)-(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylideneamino]-2-(4-phenylpiperazin-1-yl)sulfonylaniline.
| Compound Name | 4-nitro-N-[(Z)-(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylideneamino]-2-(4-phenylpiperazin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 124598206 |
| Molecular Formula | C32H27N7O6S2 |
| Molecular Weight | 669.75 g/mol |
| Exact Mass | 669.15 |
| IUPAC Name | 4-nitro-N-[(Z)-(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylideneamino]-2-(4-phenylpiperazin-1-yl)sulfonylaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C\c2ccc(Sc3cccc4cccnc34)c([N+](=O)[O-])c2)c(S(=O)(=O)N2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C32H27N7O6S2/c40-38(41)26-12-13-27(31(21-26)47(44,45)37-18-16-36(17-19-37)25-8-2-1-3-9-25)35-34-22-23-11-14-29(28(20-23)39(42)43)46-30-10-4-6-24-7-5-15-33-32(24)30/h1-15,20-22,35H,16-19H2/b34-22- |
| InChIKey | GQOIFYPQCJEBOY-VQNDASPWSA-N |
| XLogP | 6.16 |
| TPSA | 164.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.75 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|