C28H28N6O6S2 — CID 124530192
5-nitro-2-[(2Z)-2-[(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylidene]hydrazinyl]-N,N-dipropylbenzenesulfonamide (PubChem CID 124530192) has the molecular formula C28H28N6O6S2 and a molecular weight of 608.70 g/mol. Its IUPAC name is 5-nitro-2-[(2Z)-2-[(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylidene]hydrazinyl]-N,N-dipropylbenzenesulfonamide.
| Compound Name | 5-nitro-2-[(2Z)-2-[(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylidene]hydrazinyl]-N,N-dipropylbenzenesulfonamide |
|---|---|
| PubChem CID | 124530192 |
| Molecular Formula | C28H28N6O6S2 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | 5-nitro-2-[(2Z)-2-[(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylidene]hydrazinyl]-N,N-dipropylbenzenesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1N/N=C\c1ccc(Sc2cccc3cccnc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H28N6O6S2/c1-3-15-32(16-4-2)42(39,40)27-18-22(33(35)36)11-12-23(27)31-30-19-20-10-13-25(24(17-20)34(37)38)41-26-9-5-7-21-8-6-14-29-28(21)26/h5-14,17-19,31H,3-4,15-16H2,1-2H3/b30-19- |
| InChIKey | QDNYEIFALSXAPW-FSGOGVSDSA-N |
| XLogP | 6.46 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|