C26H22N6O6S3 — CID 124530050
2-[(2Z)-2-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylidene]hydrazinyl]-5-nitro-N,N-bis(prop-2-enyl)benzenesulfonamide (PubChem CID 124530050) has the molecular formula C26H22N6O6S3 and a molecular weight of 610.70 g/mol. Its IUPAC name is 2-[(2Z)-2-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylidene]hydrazinyl]-5-nitro-N,N-bis(prop-2-enyl)benzenesulfonamide.
| Compound Name | 2-[(2Z)-2-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylidene]hydrazinyl]-5-nitro-N,N-bis(prop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 124530050 |
| Molecular Formula | C26H22N6O6S3 |
| Molecular Weight | 610.70 g/mol |
| Exact Mass | 610.08 |
| IUPAC Name | 2-[(2Z)-2-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylidene]hydrazinyl]-5-nitro-N,N-bis(prop-2-enyl)benzenesulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1cc([N+](=O)[O-])ccc1N/N=C\c1ccc(Sc2nc3ccccc3s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H22N6O6S3/c1-3-13-30(14-4-2)41(37,38)25-16-19(31(33)34)10-11-21(25)29-27-17-18-9-12-24(22(15-18)32(35)36)40-26-28-20-7-5-6-8-23(20)39-26/h3-12,15-17,29H,1-2,13-14H2/b27-17- |
| InChIKey | LADNJUXRWKENMR-PKAZHMFMSA-N |
| XLogP | 6.07 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.70 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|