C24H20N6O6S2 — CID 98085734
N,N-dimethyl-5-nitro-2-[(2Z)-2-[(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylidene]hydrazinyl]benzenesulfonamide (PubChem CID 98085734) has the molecular formula C24H20N6O6S2 and a molecular weight of 552.59 g/mol. Its IUPAC name is N,N-dimethyl-5-nitro-2-[(2Z)-2-[(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-5-nitro-2-[(2Z)-2-[(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 98085734 |
| Molecular Formula | C24H20N6O6S2 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | N,N-dimethyl-5-nitro-2-[(2Z)-2-[(3-nitro-4-quinolin-8-ylsulfanylphenyl)methylidene]hydrazinyl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc([N+](=O)[O-])ccc1N/N=C\c1ccc(Sc2cccc3cccnc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H20N6O6S2/c1-28(2)38(35,36)23-14-18(29(31)32)9-10-19(23)27-26-15-16-8-11-21(20(13-16)30(33)34)37-22-7-3-5-17-6-4-12-25-24(17)22/h3-15,27H,1-2H3/b26-15- |
| InChIKey | PHLOWGTVTDXPCZ-YSMPRRRNSA-N |
| XLogP | 4.90 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|