C20H15N5O6S — CID 6264527
N-[(Z)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-2,4-dinitroaniline (PubChem CID 6264527) has the molecular formula C20H15N5O6S and a molecular weight of 453.44 g/mol. Its IUPAC name is N-[(Z)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 6264527 |
| Molecular Formula | C20H15N5O6S |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-[(Z)-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-2,4-dinitroaniline |
| SMILES | Cc1ccc(Sc2ccc(/C=N\Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H15N5O6S/c1-13-2-6-16(7-3-13)32-20-9-4-14(10-19(20)25(30)31)12-21-22-17-8-5-15(23(26)27)11-18(17)24(28)29/h2-12,22H,1H3/b21-12- |
| InChIKey | HYJOZYWITBXZCV-MTJSOVHGSA-N |
| XLogP | 5.32 |
| TPSA | 153.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|