C17H18N4O5S — CID 4091964
2-[2-(furan-2-ylmethylidene)hydrazinyl]-5-nitro-N,N-bis(prop-2-enyl)benzenesulfonamide (PubChem CID 4091964) has the molecular formula C17H18N4O5S and a molecular weight of 390.42 g/mol. Its IUPAC name is 2-[2-(furan-2-ylmethylidene)hydrazinyl]-5-nitro-N,N-bis(prop-2-enyl)benzenesulfonamide.
| Compound Name | 2-[2-(furan-2-ylmethylidene)hydrazinyl]-5-nitro-N,N-bis(prop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4091964 |
| Molecular Formula | C17H18N4O5S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-[2-(furan-2-ylmethylidene)hydrazinyl]-5-nitro-N,N-bis(prop-2-enyl)benzenesulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1cc([N+](=O)[O-])ccc1NN=Cc1ccco1 |
| InChI | InChI=1S/C17H18N4O5S/c1-3-9-20(10-4-2)27(24,25)17-12-14(21(22)23)7-8-16(17)19-18-13-15-6-5-11-26-15/h3-8,11-13,19H,1-2,9-10H2 |
| InChIKey | RNVLRKQWKZNIFC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|