C18H19F3N4O4S — CID 4663452
N,N-diethyl-5-nitro-2-[2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]benzenesulfonamide (PubChem CID 4663452) has the molecular formula C18H19F3N4O4S and a molecular weight of 444.44 g/mol. Its IUPAC name is N,N-diethyl-5-nitro-2-[2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-5-nitro-2-[2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4663452 |
| Molecular Formula | C18H19F3N4O4S |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N,N-diethyl-5-nitro-2-[2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1NN=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3N4O4S/c1-3-24(4-2)30(28,29)17-11-15(25(26)27)9-10-16(17)23-22-12-13-5-7-14(8-6-13)18(19,20)21/h5-12,23H,3-4H2,1-2H3 |
| InChIKey | PMTLJNOPJCYKDM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|