C19H24N4O7S — CID 3391598
N,N-diethyl-2-[2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide (PubChem CID 3391598) has the molecular formula C19H24N4O7S and a molecular weight of 452.49 g/mol. Its IUPAC name is N,N-diethyl-2-[2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-2-[2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3391598 |
| Molecular Formula | C19H24N4O7S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | N,N-diethyl-2-[2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1NN=Cc1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C19H24N4O7S/c1-5-22(6-2)31(27,28)18-11-14(23(25)26)7-8-15(18)21-20-12-13-9-16(29-3)19(24)17(10-13)30-4/h7-12,21,24H,5-6H2,1-4H3 |
| InChIKey | INFNTXPBJFDQEV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|