C19H15N7O2S — CID 6416524
N-[(Z)-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]phthalazin-1-amine (PubChem CID 6416524) has the molecular formula C19H15N7O2S and a molecular weight of 405.44 g/mol. Its IUPAC name is N-[(Z)-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]phthalazin-1-amine.
| Compound Name | N-[(Z)-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]phthalazin-1-amine |
|---|---|
| PubChem CID | 6416524 |
| Molecular Formula | C19H15N7O2S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[(Z)-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]phthalazin-1-amine |
| SMILES | Cn1ccnc1Sc1ccc(/C=N\Nc2nncc3ccccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15N7O2S/c1-25-9-8-20-19(25)29-17-7-6-13(10-16(17)26(27)28)11-21-23-18-15-5-3-2-4-14(15)12-22-24-18/h2-12H,1H3,(H,23,24)/b21-11- |
| InChIKey | YXQVHABSVXRZLR-NHDPSOOVSA-N |
| XLogP | 3.87 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|