C20H12N4O5 — CID 136691071
10-[(2,4-dinitrophenyl)diazenyl]anthracen-9-ol (PubChem CID 136691071) has the molecular formula C20H12N4O5 and a molecular weight of 388.34 g/mol. Its IUPAC name is 10-[(2,4-dinitrophenyl)diazenyl]anthracen-9-ol.
| Compound Name | 10-[(2,4-dinitrophenyl)diazenyl]anthracen-9-ol |
|---|---|
| PubChem CID | 136691071 |
| Molecular Formula | C20H12N4O5 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 10-[(2,4-dinitrophenyl)diazenyl]anthracen-9-ol |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2c3ccccc3c(O)c3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H12N4O5/c25-20-15-7-3-1-5-13(15)19(14-6-2-4-8-16(14)20)22-21-17-10-9-12(23(26)27)11-18(17)24(28)29/h1-11,25H/b22-21+ |
| InChIKey | IYVCOWSPRAHZSW-QURGRASLSA-N |
| XLogP | 5.93 |
| TPSA | 131.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|