C16H11N5O5 — CID 3945122
6-hydroxy-5-[(2-nitro-4-phenylphenyl)diazenyl]-1H-pyrimidine-2,4-dione (PubChem CID 3945122) has the molecular formula C16H11N5O5 and a molecular weight of 353.29 g/mol. Its IUPAC name is 6-hydroxy-5-[(2-nitro-4-phenylphenyl)diazenyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(2-nitro-4-phenylphenyl)diazenyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3945122 |
| Molecular Formula | C16H11N5O5 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 6-hydroxy-5-[(2-nitro-4-phenylphenyl)diazenyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c(/N=N/c2ccc(-c3ccccc3)cc2[N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C16H11N5O5/c22-14-13(15(23)18-16(24)17-14)20-19-11-7-6-10(8-12(11)21(25)26)9-4-2-1-3-5-9/h1-8H,(H3,17,18,22,23,24)/b20-19+ |
| InChIKey | LBZOFHRZWLKMOE-FMQUCBEESA-N |
| XLogP | 2.76 |
| TPSA | 153.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|