C18H17N3O5 — CID 135417170
ethyl (Z)-3-hydroxy-2-[(2-nitro-4-phenylphenyl)diazenyl]but-2-enoate (PubChem CID 135417170) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is ethyl (Z)-3-hydroxy-2-[(2-nitro-4-phenylphenyl)diazenyl]but-2-enoate.
| Compound Name | ethyl (Z)-3-hydroxy-2-[(2-nitro-4-phenylphenyl)diazenyl]but-2-enoate |
|---|---|
| PubChem CID | 135417170 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | ethyl (Z)-3-hydroxy-2-[(2-nitro-4-phenylphenyl)diazenyl]but-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccc(-c2ccccc2)cc1[N+](=O)[O-])=C(\C)O |
| InChI | InChI=1S/C18H17N3O5/c1-3-26-18(23)17(12(2)22)20-19-15-10-9-14(11-16(15)21(24)25)13-7-5-4-6-8-13/h4-11,22H,3H2,1-2H3/b17-12-,20-19+ |
| InChIKey | CGYGPJYWYUHWRY-QLJNEMMGSA-N |
| XLogP | 4.70 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|