C28H34N4O9 — CID 135480246
ethyl (Z)-2-[[2-[2-[2-[2-[[(E)-1-ethoxy-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]phenoxy]ethoxy]ethoxy]phenyl]diazenyl]-3-hydroxybut-2-enoate (PubChem CID 135480246) has the molecular formula C28H34N4O9 and a molecular weight of 570.60 g/mol. Its IUPAC name is ethyl (Z)-2-[[2-[2-[2-[2-[[(E)-1-ethoxy-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]phenoxy]ethoxy]ethoxy]phenyl]diazenyl]-3-hydroxybut-2-enoate.
| Compound Name | ethyl (Z)-2-[[2-[2-[2-[2-[[(E)-1-ethoxy-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]phenoxy]ethoxy]ethoxy]phenyl]diazenyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135480246 |
| Molecular Formula | C28H34N4O9 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | ethyl (Z)-2-[[2-[2-[2-[2-[[(E)-1-ethoxy-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]phenoxy]ethoxy]ethoxy]phenyl]diazenyl]-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccccc1OCCOCCOc1ccccc1/N=N/C(C(=O)OCC)=C(\C)O)=C(\C)O |
| InChI | InChI=1S/C28H34N4O9/c1-5-38-27(35)25(19(3)33)31-29-21-11-7-9-13-23(21)40-17-15-37-16-18-41-24-14-10-8-12-22(24)30-32-26(20(4)34)28(36)39-6-2/h7-14,33-34H,5-6,15-18H2,1-4H3/b25-19-,26-20+,31-29+,32-30+ |
| InChIKey | GBUXHQHFDDXQKC-VIIJOSQUSA-N |
| XLogP | 6.03 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|