C12H10BrN3O3 — CID 138392027
ethyl (Z)-2-[(2-bromophenyl)diazenyl]-3-cyano-3-hydroxyprop-2-enoate (PubChem CID 138392027) has the molecular formula C12H10BrN3O3 and a molecular weight of 324.13 g/mol. Its IUPAC name is ethyl (Z)-2-[(2-bromophenyl)diazenyl]-3-cyano-3-hydroxyprop-2-enoate.
| Compound Name | ethyl (Z)-2-[(2-bromophenyl)diazenyl]-3-cyano-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 138392027 |
| Molecular Formula | C12H10BrN3O3 |
| Molecular Weight | 324.13 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | ethyl (Z)-2-[(2-bromophenyl)diazenyl]-3-cyano-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccccc1Br)=C(/O)C#N |
| InChI | InChI=1S/C12H10BrN3O3/c1-2-19-12(18)11(10(17)7-14)16-15-9-6-4-3-5-8(9)13/h3-6,17H,2H2,1H3/b11-10-,16-15+ |
| InChIKey | AQVDQIYAAWVTFU-JXNPCESCSA-N |
| XLogP | 3.39 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.13 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|