C19H19N3O4 — CID 138392048
ethyl (Z)-3-cyano-2-[(2,3-dimethyl-5-oxo-4-phenylcyclopenten-1-yl)diazenyl]-3-hydroxyprop-2-enoate (PubChem CID 138392048) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is ethyl (Z)-3-cyano-2-[(2,3-dimethyl-5-oxo-4-phenylcyclopenten-1-yl)diazenyl]-3-hydroxyprop-2-enoate.
| Compound Name | ethyl (Z)-3-cyano-2-[(2,3-dimethyl-5-oxo-4-phenylcyclopenten-1-yl)diazenyl]-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 138392048 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | ethyl (Z)-3-cyano-2-[(2,3-dimethyl-5-oxo-4-phenylcyclopenten-1-yl)diazenyl]-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(/N=N/C1=C(C)C(C)C(c2ccccc2)C1=O)=C(/O)C#N |
| InChI | InChI=1S/C19H19N3O4/c1-4-26-19(25)17(14(23)10-20)22-21-16-12(3)11(2)15(18(16)24)13-8-6-5-7-9-13/h5-9,11,15,23H,4H2,1-3H3/b17-14-,22-21+ |
| InChIKey | IIQADQKNQKKHMT-COVHOIMISA-N |
| XLogP | 3.57 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|