C12H13ClN2O3 — CID 135543149
ethyl (E)-2-[(2-chlorophenyl)diazenyl]-3-hydroxybut-2-enoate (PubChem CID 135543149) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is ethyl (E)-2-[(2-chlorophenyl)diazenyl]-3-hydroxybut-2-enoate.
| Compound Name | ethyl (E)-2-[(2-chlorophenyl)diazenyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135543149 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | ethyl (E)-2-[(2-chlorophenyl)diazenyl]-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccccc1Cl)=C(/C)O |
| InChI | InChI=1S/C12H13ClN2O3/c1-3-18-12(17)11(8(2)16)15-14-10-7-5-4-6-9(10)13/h4-7,16H,3H2,1-2H3/b11-8+,15-14+ |
| InChIKey | OPSYMAKKHSULSJ-IIXCLMFLSA-N |
| XLogP | 3.78 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|