C13H15BrN2O4 — CID 137190213
ethyl 2-[(3-bromo-2-methoxyphenyl)diazenyl]-3-hydroxybut-2-enoate (PubChem CID 137190213) has the molecular formula C13H15BrN2O4 and a molecular weight of 343.18 g/mol. Its IUPAC name is ethyl 2-[(3-bromo-2-methoxyphenyl)diazenyl]-3-hydroxybut-2-enoate.
| Compound Name | ethyl 2-[(3-bromo-2-methoxyphenyl)diazenyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 137190213 |
| Molecular Formula | C13H15BrN2O4 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | ethyl 2-[(3-bromo-2-methoxyphenyl)diazenyl]-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1cccc(Br)c1OC)=C(C)O |
| InChI | InChI=1S/C13H15BrN2O4/c1-4-20-13(18)11(8(2)17)16-15-10-7-5-6-9(14)12(10)19-3/h5-7,17H,4H2,1-3H3/b11-8?,16-15+ |
| InChIKey | WARXFLBSHQBPPB-VNVSJKAVSA-N |
| XLogP | 3.89 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|