C16H15ClF3N5O3S — CID 135475579
ethyl (Z)-2-[(2-chlorophenyl)diazenyl]-3-hydroxy-4-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]but-2-enoate (PubChem CID 135475579) has the molecular formula C16H15ClF3N5O3S and a molecular weight of 449.84 g/mol. Its IUPAC name is ethyl (Z)-2-[(2-chlorophenyl)diazenyl]-3-hydroxy-4-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]but-2-enoate.
| Compound Name | ethyl (Z)-2-[(2-chlorophenyl)diazenyl]-3-hydroxy-4-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]but-2-enoate |
|---|---|
| PubChem CID | 135475579 |
| Molecular Formula | C16H15ClF3N5O3S |
| Molecular Weight | 449.84 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | ethyl (Z)-2-[(2-chlorophenyl)diazenyl]-3-hydroxy-4-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]but-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccccc1Cl)=C(/O)CSc1nnc(C(F)(F)F)n1C |
| InChI | InChI=1S/C16H15ClF3N5O3S/c1-3-28-13(27)12(22-21-10-7-5-4-6-9(10)17)11(26)8-29-15-24-23-14(25(15)2)16(18,19)20/h4-7,26H,3,8H2,1-2H3/b12-11-,22-21+ |
| InChIKey | JAIYPSSZRLZBTH-CAYADMIQSA-N |
| XLogP | 4.70 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.84 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|