C20H20ClN3O5 — CID 135548084
ethyl 2-[(4-benzamido-2-chloro-5-methoxyphenyl)diazenyl]-3-hydroxybut-2-enoate (PubChem CID 135548084) has the molecular formula C20H20ClN3O5 and a molecular weight of 417.85 g/mol. Its IUPAC name is ethyl 2-[(4-benzamido-2-chloro-5-methoxyphenyl)diazenyl]-3-hydroxybut-2-enoate.
| Compound Name | ethyl 2-[(4-benzamido-2-chloro-5-methoxyphenyl)diazenyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135548084 |
| Molecular Formula | C20H20ClN3O5 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | ethyl 2-[(4-benzamido-2-chloro-5-methoxyphenyl)diazenyl]-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1cc(OC)c(NC(=O)c2ccccc2)cc1Cl)=C(C)O |
| InChI | InChI=1S/C20H20ClN3O5/c1-4-29-20(27)18(12(2)25)24-23-15-11-17(28-3)16(10-14(15)21)22-19(26)13-8-6-5-7-9-13/h5-11,25H,4H2,1-3H3,(H,22,26)/b18-12?,24-23+ |
| InChIKey | DWYSVNJNCASTRA-FWHWWSERSA-N |
| XLogP | 5.04 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|