C24H27N5O5 — CID 136900153
4-(dibutylamino)-1-[(2,4-dinitrophenyl)diazenyl]naphthalen-2-ol (PubChem CID 136900153) has the molecular formula C24H27N5O5 and a molecular weight of 465.51 g/mol. Its IUPAC name is 4-(dibutylamino)-1-[(2,4-dinitrophenyl)diazenyl]naphthalen-2-ol.
| Compound Name | 4-(dibutylamino)-1-[(2,4-dinitrophenyl)diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 136900153 |
| Molecular Formula | C24H27N5O5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 4-(dibutylamino)-1-[(2,4-dinitrophenyl)diazenyl]naphthalen-2-ol |
| SMILES | CCCCN(CCCC)c1cc(O)c(/N=N/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C24H27N5O5/c1-3-5-13-27(14-6-4-2)21-16-23(30)24(19-10-8-7-9-18(19)21)26-25-20-12-11-17(28(31)32)15-22(20)29(33)34/h7-12,15-16,30H,3-6,13-14H2,1-2H3/b26-25+ |
| InChIKey | DBTNTGGIDFRLTC-OCEACIFDSA-N |
| XLogP | 7.18 |
| TPSA | 134.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|