C19H20ClN5O4S — CID 135971696
3-[(2-chlorophenyl)diazenyl]-2-hydroxy-N-(morpholin-4-ylmethyl)-1H-indole-5-sulfonamide (PubChem CID 135971696) has the molecular formula C19H20ClN5O4S and a molecular weight of 449.92 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)diazenyl]-2-hydroxy-N-(morpholin-4-ylmethyl)-1H-indole-5-sulfonamide.
| Compound Name | 3-[(2-chlorophenyl)diazenyl]-2-hydroxy-N-(morpholin-4-ylmethyl)-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 135971696 |
| Molecular Formula | C19H20ClN5O4S |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 3-[(2-chlorophenyl)diazenyl]-2-hydroxy-N-(morpholin-4-ylmethyl)-1H-indole-5-sulfonamide |
| SMILES | O=S(=O)(NCN1CCOCC1)c1ccc2[nH]c(O)c(/N=N/c3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C19H20ClN5O4S/c20-15-3-1-2-4-17(15)23-24-18-14-11-13(5-6-16(14)22-19(18)26)30(27,28)21-12-25-7-9-29-10-8-25/h1-6,11,21-22,26H,7-10,12H2/b24-23+ |
| InChIKey | WJLDLACQCPFVOO-WCWDXBQESA-N |
| XLogP | 3.51 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|