C26H19N3O5S2 — CID 135856088
3-[[2-(benzenesulfonyl)phenyl]diazenyl]-2-phenyl-1H-indole-5-sulfonic acid (PubChem CID 135856088) has the molecular formula C26H19N3O5S2 and a molecular weight of 517.59 g/mol. Its IUPAC name is 3-[[2-(benzenesulfonyl)phenyl]diazenyl]-2-phenyl-1H-indole-5-sulfonic acid.
| Compound Name | 3-[[2-(benzenesulfonyl)phenyl]diazenyl]-2-phenyl-1H-indole-5-sulfonic acid |
|---|---|
| PubChem CID | 135856088 |
| Molecular Formula | C26H19N3O5S2 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | 3-[[2-(benzenesulfonyl)phenyl]diazenyl]-2-phenyl-1H-indole-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2[nH]c(-c3ccccc3)c(/N=N/c3ccccc3S(=O)(=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C26H19N3O5S2/c30-35(31,19-11-5-2-6-12-19)24-14-8-7-13-23(24)28-29-26-21-17-20(36(32,33)34)15-16-22(21)27-25(26)18-9-3-1-4-10-18/h1-17,27H,(H,32,33,34)/b29-28+ |
| InChIKey | XFTAPGSPMBSPQB-ZQHSETAFSA-N |
| XLogP | 6.33 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|