C16H12N2O8S2 — CID 14550091
3-hydroxy-2-(3-hydroxy-5-sulfo-1H-indol-2-yl)-1H-indole-5-sulfonic acid (PubChem CID 14550091) has the molecular formula C16H12N2O8S2 and a molecular weight of 424.41 g/mol. Its IUPAC name is 3-hydroxy-2-(3-hydroxy-5-sulfo-1H-indol-2-yl)-1H-indole-5-sulfonic acid.
| Compound Name | 3-hydroxy-2-(3-hydroxy-5-sulfo-1H-indol-2-yl)-1H-indole-5-sulfonic acid |
|---|---|
| PubChem CID | 14550091 |
| Molecular Formula | C16H12N2O8S2 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 3-hydroxy-2-(3-hydroxy-5-sulfo-1H-indol-2-yl)-1H-indole-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2[nH]c(-c3[nH]c4ccc(S(=O)(=O)O)cc4c3O)c(O)c2c1 |
| InChI | InChI=1S/C16H12N2O8S2/c19-15-9-5-7(27(21,22)23)1-3-11(9)17-13(15)14-16(20)10-6-8(28(24,25)26)2-4-12(10)18-14/h1-6,17-20H,(H,21,22,23)(H,24,25,26) |
| InChIKey | OXJBWODAZWWGTP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 180.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|