C21H16N2O4S — CID 154432622
3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-5-sulfonic acid (PubChem CID 154432622) has the molecular formula C21H16N2O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-5-sulfonic acid.
| Compound Name | 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-5-sulfonic acid |
|---|---|
| PubChem CID | 154432622 |
| Molecular Formula | C21H16N2O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 3-(C,N-diphenylcarbonimidoyl)-2-hydroxy-1H-indole-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2[nH]c(O)c(/C(=N/c3ccccc3)c3ccccc3)c2c1 |
| InChI | InChI=1S/C21H16N2O4S/c24-21-19(17-13-16(28(25,26)27)11-12-18(17)23-21)20(14-7-3-1-4-8-14)22-15-9-5-2-6-10-15/h1-13,23-24H,(H,25,26,27)/b22-20+ |
| InChIKey | OJIGLOOZQBRUMV-LSDHQDQOSA-N |
| XLogP | 4.29 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|