C25H26N4O3S — CID 135622091
N-[2-(dimethylamino)ethyl]-4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]benzenesulfonamide (PubChem CID 135622091) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]benzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 135622091 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]benzenesulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1ccc(/N=C(\c2ccccc2)c2c(O)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H26N4O3S/c1-29(2)17-16-26-33(31,32)20-14-12-19(13-15-20)27-24(18-8-4-3-5-9-18)23-21-10-6-7-11-22(21)28-25(23)30/h3-15,26,28,30H,16-17H2,1-2H3/b27-24+ |
| InChIKey | ZIEDELULAMULBX-SOYKGTTHSA-N |
| XLogP | 3.88 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|