C28H30N4O4S — CID 135621961
N-ethyl-N-[2-[4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]-N-methylsulfonylanilino]ethyl]acetamide (PubChem CID 135621961) has the molecular formula C28H30N4O4S and a molecular weight of 518.64 g/mol. Its IUPAC name is N-ethyl-N-[2-[4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]-N-methylsulfonylanilino]ethyl]acetamide.
| Compound Name | N-ethyl-N-[2-[4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]-N-methylsulfonylanilino]ethyl]acetamide |
|---|---|
| PubChem CID | 135621961 |
| Molecular Formula | C28H30N4O4S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | N-ethyl-N-[2-[4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]-N-methylsulfonylanilino]ethyl]acetamide |
| SMILES | CCN(CCN(c1ccc(/N=C(\c2ccccc2)c2c(O)[nH]c3ccccc23)cc1)S(C)(=O)=O)C(C)=O |
| InChI | InChI=1S/C28H30N4O4S/c1-4-31(20(2)33)18-19-32(37(3,35)36)23-16-14-22(15-17-23)29-27(21-10-6-5-7-11-21)26-24-12-8-9-13-25(24)30-28(26)34/h5-17,30,34H,4,18-19H2,1-3H3/b29-27+ |
| InChIKey | GFNGFUWXYNFLAV-ORIPQNMZSA-N |
| XLogP | 4.68 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|