C29H32N4O6S — CID 135585795
2-[4-[[(5,6-diethoxy-2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]-N-methylsulfonylanilino]-N-methylacetamide (PubChem CID 135585795) has the molecular formula C29H32N4O6S and a molecular weight of 564.66 g/mol. Its IUPAC name is 2-[4-[[(5,6-diethoxy-2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]-N-methylsulfonylanilino]-N-methylacetamide.
| Compound Name | 2-[4-[[(5,6-diethoxy-2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]-N-methylsulfonylanilino]-N-methylacetamide |
|---|---|
| PubChem CID | 135585795 |
| Molecular Formula | C29H32N4O6S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 2-[4-[[(5,6-diethoxy-2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]-N-methylsulfonylanilino]-N-methylacetamide |
| SMILES | CCOc1cc2[nH]c(O)c(/C(=N/c3ccc(N(CC(=O)NC)S(C)(=O)=O)cc3)c3ccccc3)c2cc1OCC |
| InChI | InChI=1S/C29H32N4O6S/c1-5-38-24-16-22-23(17-25(24)39-6-2)32-29(35)27(22)28(19-10-8-7-9-11-19)31-20-12-14-21(15-13-20)33(40(4,36)37)18-26(34)30-3/h7-17,32,35H,5-6,18H2,1-4H3,(H,30,34)/b31-28+ |
| InChIKey | NEPHROGMCAXAMW-CCFHIKDMSA-N |
| XLogP | 4.35 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|