C27H29N3O3 — CID 135585736
5,6-diethoxy-3-[N-[4-(methylaminomethyl)phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol (PubChem CID 135585736) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 5,6-diethoxy-3-[N-[4-(methylaminomethyl)phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol.
| Compound Name | 5,6-diethoxy-3-[N-[4-(methylaminomethyl)phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 135585736 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 5,6-diethoxy-3-[N-[4-(methylaminomethyl)phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol |
| SMILES | CCOc1cc2[nH]c(O)c(/C(=N/c3ccc(CNC)cc3)c3ccccc3)c2cc1OCC |
| InChI | InChI=1S/C27H29N3O3/c1-4-32-23-15-21-22(16-24(23)33-5-2)30-27(31)25(21)26(19-9-7-6-8-10-19)29-20-13-11-18(12-14-20)17-28-3/h6-16,28,30-31H,4-5,17H2,1-3H3/b29-26+ |
| InChIKey | VRICZFNZIOHHOP-PBBVDAKRSA-N |
| XLogP | 5.56 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|