C28H31N3O3 — CID 135585797
5,6-diethoxy-3-[N-[4-[2-(methylamino)ethyl]phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol (PubChem CID 135585797) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is 5,6-diethoxy-3-[N-[4-[2-(methylamino)ethyl]phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol.
| Compound Name | 5,6-diethoxy-3-[N-[4-[2-(methylamino)ethyl]phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 135585797 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 5,6-diethoxy-3-[N-[4-[2-(methylamino)ethyl]phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol |
| SMILES | CCOc1cc2[nH]c(O)c(/C(=N/c3ccc(CCNC)cc3)c3ccccc3)c2cc1OCC |
| InChI | InChI=1S/C28H31N3O3/c1-4-33-24-17-22-23(18-25(24)34-5-2)31-28(32)26(22)27(20-9-7-6-8-10-20)30-21-13-11-19(12-14-21)15-16-29-3/h6-14,17-18,29,31-32H,4-5,15-16H2,1-3H3/b30-27+ |
| InChIKey | MNUZBWKWGOUDMG-KDJFERLWSA-N |
| XLogP | 5.60 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|