C30H33N3O3 — CID 135837813
ethyl 3-[N-[4-[2-(diethylamino)ethyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate (PubChem CID 135837813) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is ethyl 3-[N-[4-[2-(diethylamino)ethyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate.
| Compound Name | ethyl 3-[N-[4-[2-(diethylamino)ethyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 135837813 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | ethyl 3-[N-[4-[2-(diethylamino)ethyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(/C(=N/c3ccc(CCN(CC)CC)cc3)c3ccccc3)c(O)[nH]c2c1 |
| InChI | InChI=1S/C30H33N3O3/c1-4-33(5-2)19-18-21-12-15-24(16-13-21)31-28(22-10-8-7-9-11-22)27-25-17-14-23(30(35)36-6-3)20-26(25)32-29(27)34/h7-17,20,32,34H,4-6,18-19H2,1-3H3/b31-28+ |
| InChIKey | KAWQQZUXCIMCFO-CCFHIKDMSA-N |
| XLogP | 6.10 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|