C27H23N5O3 — CID 135837921
ethyl 2-hydroxy-3-[C-phenyl-N-[4-(triazol-2-ylmethyl)phenyl]carbonimidoyl]-1H-indole-6-carboxylate (PubChem CID 135837921) has the molecular formula C27H23N5O3 and a molecular weight of 465.51 g/mol. Its IUPAC name is ethyl 2-hydroxy-3-[C-phenyl-N-[4-(triazol-2-ylmethyl)phenyl]carbonimidoyl]-1H-indole-6-carboxylate.
| Compound Name | ethyl 2-hydroxy-3-[C-phenyl-N-[4-(triazol-2-ylmethyl)phenyl]carbonimidoyl]-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 135837921 |
| Molecular Formula | C27H23N5O3 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | ethyl 2-hydroxy-3-[C-phenyl-N-[4-(triazol-2-ylmethyl)phenyl]carbonimidoyl]-1H-indole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(/C(=N/c3ccc(Cn4nccn4)cc3)c3ccccc3)c(O)[nH]c2c1 |
| InChI | InChI=1S/C27H23N5O3/c1-2-35-27(34)20-10-13-22-23(16-20)31-26(33)24(22)25(19-6-4-3-5-7-19)30-21-11-8-18(9-12-21)17-32-28-14-15-29-32/h3-16,31,33H,2,17H2,1H3/b30-25+ |
| InChIKey | MDPWVSPPHVGASU-QCWLDUFUSA-N |
| XLogP | 4.86 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|