C23H17FN2O3 — CID 135838048
methyl 3-[N-(4-fluorophenyl)-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate (PubChem CID 135838048) has the molecular formula C23H17FN2O3 and a molecular weight of 388.40 g/mol. Its IUPAC name is methyl 3-[N-(4-fluorophenyl)-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate.
| Compound Name | methyl 3-[N-(4-fluorophenyl)-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 135838048 |
| Molecular Formula | C23H17FN2O3 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | methyl 3-[N-(4-fluorophenyl)-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(/C(=N/c3ccc(F)cc3)c3ccccc3)c(O)[nH]c2c1 |
| InChI | InChI=1S/C23H17FN2O3/c1-29-23(28)15-7-12-18-19(13-15)26-22(27)20(18)21(14-5-3-2-4-6-14)25-17-10-8-16(24)9-11-17/h2-13,26-27H,1H3/b25-21+ |
| InChIKey | IKJCDFPMUVHZFF-NJNXFGOHSA-N |
| XLogP | 4.97 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|